C21H15FN4O4S2 — CID 44942903
N-[(E)-(4-ethoxyphenyl)methylideneamino]-N-(6-fluoro-1,3-benzothiazol-2-yl)-5-nitrothiophene-2-carboxamide (PubChem CID 44942903) has the molecular formula C21H15FN4O4S2 and a molecular weight of 470.51 g/mol. Its IUPAC name is N-[(E)-(4-ethoxyphenyl)methylideneamino]-N-(6-fluoro-1,3-benzothiazol-2-yl)-5-nitrothiophene-2-carboxamide.
| Compound Name | N-[(E)-(4-ethoxyphenyl)methylideneamino]-N-(6-fluoro-1,3-benzothiazol-2-yl)-5-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 44942903 |
| Molecular Formula | C21H15FN4O4S2 |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | N-[(E)-(4-ethoxyphenyl)methylideneamino]-N-(6-fluoro-1,3-benzothiazol-2-yl)-5-nitrothiophene-2-carboxamide |
| SMILES | CCOc1ccc(/C=N/N(C(=O)c2ccc([N+](=O)[O-])s2)c2nc3ccc(F)cc3s2)cc1 |
| InChI | InChI=1S/C21H15FN4O4S2/c1-2-30-15-6-3-13(4-7-15)12-23-25(20(27)17-9-10-19(31-17)26(28)29)21-24-16-8-5-14(22)11-18(16)32-21/h3-12H,2H2,1H3/b23-12+ |
| InChIKey | GAFSPYHFBOXKRZ-FSJBWODESA-N |
| XLogP | 5.48 |
| TPSA | 97.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|