C25H17ClFN3O2S2 — CID 44942918
3-chloro-N-[(E)-(4-ethoxyphenyl)methylideneamino]-N-(6-fluoro-1,3-benzothiazol-2-yl)-1-benzothiophene-2-carboxamide (PubChem CID 44942918) has the molecular formula C25H17ClFN3O2S2 and a molecular weight of 510.02 g/mol. Its IUPAC name is 3-chloro-N-[(E)-(4-ethoxyphenyl)methylideneamino]-N-(6-fluoro-1,3-benzothiazol-2-yl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[(E)-(4-ethoxyphenyl)methylideneamino]-N-(6-fluoro-1,3-benzothiazol-2-yl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 44942918 |
| Molecular Formula | C25H17ClFN3O2S2 |
| Molecular Weight | 510.02 g/mol |
| Exact Mass | 509.04 |
| IUPAC Name | 3-chloro-N-[(E)-(4-ethoxyphenyl)methylideneamino]-N-(6-fluoro-1,3-benzothiazol-2-yl)-1-benzothiophene-2-carboxamide |
| SMILES | CCOc1ccc(/C=N/N(C(=O)c2sc3ccccc3c2Cl)c2nc3ccc(F)cc3s2)cc1 |
| InChI | InChI=1S/C25H17ClFN3O2S2/c1-2-32-17-10-7-15(8-11-17)14-28-30(25-29-19-12-9-16(27)13-21(19)34-25)24(31)23-22(26)18-5-3-4-6-20(18)33-23/h3-14H,2H2,1H3/b28-14+ |
| InChIKey | IJOMBVRMEZMDKM-CCVNUDIWSA-N |
| XLogP | 7.38 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.02 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|