C26H13ClFN3O3S2 — CID 44943841
3-chloro-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]-1-benzothiophene-2-carboxamide (PubChem CID 44943841) has the molecular formula C26H13ClFN3O3S2 and a molecular weight of 533.99 g/mol. Its IUPAC name is 3-chloro-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 44943841 |
| Molecular Formula | C26H13ClFN3O3S2 |
| Molecular Weight | 533.99 g/mol |
| Exact Mass | 533.01 |
| IUPAC Name | 3-chloro-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(c1sc2ccccc2c1Cl)N(/N=C/c1coc2ccccc2c1=O)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C26H13ClFN3O3S2/c27-22-17-6-2-4-8-20(17)35-24(22)25(33)31(26-30-18-10-9-15(28)11-21(18)36-26)29-12-14-13-34-19-7-3-1-5-16(19)23(14)32/h1-13H/b29-12+ |
| InChIKey | IVZWDGCOXIWBLF-XKJRVUDJSA-N |
| XLogP | 7.09 |
| TPSA | 75.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.99 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|