C33H25FN4O5S2 — CID 44943881
4-[benzyl(ethyl)sulfamoyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]benzamide (PubChem CID 44943881) has the molecular formula C33H25FN4O5S2 and a molecular weight of 640.72 g/mol. Its IUPAC name is 4-[benzyl(ethyl)sulfamoyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]benzamide.
| Compound Name | 4-[benzyl(ethyl)sulfamoyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44943881 |
| Molecular Formula | C33H25FN4O5S2 |
| Molecular Weight | 640.72 g/mol |
| Exact Mass | 640.13 |
| IUPAC Name | 4-[benzyl(ethyl)sulfamoyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]benzamide |
| SMILES | CCN(Cc1ccccc1)S(=O)(=O)c1ccc(C(=O)N(/N=C/c2coc3ccccc3c2=O)c2nc3ccc(F)cc3s2)cc1 |
| InChI | InChI=1S/C33H25FN4O5S2/c1-2-37(20-22-8-4-3-5-9-22)45(41,42)26-15-12-23(13-16-26)32(40)38(33-36-28-17-14-25(34)18-30(28)44-33)35-19-24-21-43-29-11-7-6-10-27(29)31(24)39/h3-19,21H,2,20H2,1H3/b35-19+ |
| InChIKey | UIOHQCFWAJVGOP-XZYGTATASA-N |
| XLogP | 6.43 |
| TPSA | 113.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.72 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|