C25H13FN4O3S2 — CID 44943830
N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]-1,3-benzothiazole-2-carboxamide (PubChem CID 44943830) has the molecular formula C25H13FN4O3S2 and a molecular weight of 500.54 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]-1,3-benzothiazole-2-carboxamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 44943830 |
| Molecular Formula | C25H13FN4O3S2 |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.04 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]-1,3-benzothiazole-2-carboxamide |
| SMILES | O=C(c1nc2ccccc2s1)N(/N=C/c1coc2ccccc2c1=O)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C25H13FN4O3S2/c26-15-9-10-18-21(11-15)35-25(29-18)30(24(32)23-28-17-6-2-4-8-20(17)34-23)27-12-14-13-33-19-7-3-1-5-16(19)22(14)31/h1-13H/b27-12+ |
| InChIKey | KXXKKGCPITYZGV-KKMKTNMSSA-N |
| XLogP | 5.83 |
| TPSA | 88.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|