C28H23N3O7S — CID 44946239
3,4,5-trimethoxy-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]benzamide (PubChem CID 44946239) has the molecular formula C28H23N3O7S and a molecular weight of 545.57 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44946239 |
| Molecular Formula | C28H23N3O7S |
| Molecular Weight | 545.57 g/mol |
| Exact Mass | 545.13 |
| IUPAC Name | 3,4,5-trimethoxy-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]benzamide |
| SMILES | COc1ccc2nc(N(/N=C/c3coc4ccccc4c3=O)C(=O)c3cc(OC)c(OC)c(OC)c3)sc2c1 |
| InChI | InChI=1S/C28H23N3O7S/c1-34-18-9-10-20-24(13-18)39-28(30-20)31(27(33)16-11-22(35-2)26(37-4)23(12-16)36-3)29-14-17-15-38-21-8-6-5-7-19(21)25(17)32/h5-15H,1-4H3/b29-14+ |
| InChIKey | FDEYQOWZBANWLC-IPPBACCNSA-N |
| XLogP | 5.12 |
| TPSA | 112.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.57 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|