C26H17Cl2N3O5S — CID 44946272
2-(2,4-dichlorophenoxy)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]acetamide (PubChem CID 44946272) has the molecular formula C26H17Cl2N3O5S and a molecular weight of 554.41 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 44946272 |
| Molecular Formula | C26H17Cl2N3O5S |
| Molecular Weight | 554.41 g/mol |
| Exact Mass | 553.03 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]acetamide |
| SMILES | COc1ccc2nc(N(/N=C/c3coc4ccccc4c3=O)C(=O)COc3ccc(Cl)cc3Cl)sc2c1 |
| InChI | InChI=1S/C26H17Cl2N3O5S/c1-34-17-7-8-20-23(11-17)37-26(30-20)31(24(32)14-36-22-9-6-16(27)10-19(22)28)29-12-15-13-35-21-5-3-2-4-18(21)25(15)33/h2-13H,14H2,1H3/b29-12+ |
| InChIKey | MZVVOZISKMYJST-XKJRVUDJSA-N |
| XLogP | 6.16 |
| TPSA | 94.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.41 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|