C21H15ClN4O6S — CID 44946168
2-(4-chlorophenoxy)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]acetamide (PubChem CID 44946168) has the molecular formula C21H15ClN4O6S and a molecular weight of 486.89 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 44946168 |
| Molecular Formula | C21H15ClN4O6S |
| Molecular Weight | 486.89 g/mol |
| Exact Mass | 486.04 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]acetamide |
| SMILES | COc1ccc2nc(N(/N=C/c3ccc([N+](=O)[O-])o3)C(=O)COc3ccc(Cl)cc3)sc2c1 |
| InChI | InChI=1S/C21H15ClN4O6S/c1-30-15-6-8-17-18(10-15)33-21(24-17)25(23-11-16-7-9-20(32-16)26(28)29)19(27)12-31-14-4-2-13(22)3-5-14/h2-11H,12H2,1H3/b23-11+ |
| InChIKey | ZVZHATGSHZYVNZ-FOKLQQMPSA-N |
| XLogP | 4.91 |
| TPSA | 120.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.89 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|