C30H27N5O7S2 — CID 44946222
4-[benzyl(propan-2-yl)sulfamoyl]-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]benzamide (PubChem CID 44946222) has the molecular formula C30H27N5O7S2 and a molecular weight of 633.71 g/mol. Its IUPAC name is 4-[benzyl(propan-2-yl)sulfamoyl]-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]benzamide.
| Compound Name | 4-[benzyl(propan-2-yl)sulfamoyl]-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44946222 |
| Molecular Formula | C30H27N5O7S2 |
| Molecular Weight | 633.71 g/mol |
| Exact Mass | 633.14 |
| IUPAC Name | 4-[benzyl(propan-2-yl)sulfamoyl]-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]benzamide |
| SMILES | COc1ccc2nc(N(/N=C/c3ccc([N+](=O)[O-])o3)C(=O)c3ccc(S(=O)(=O)N(Cc4ccccc4)C(C)C)cc3)sc2c1 |
| InChI | InChI=1S/C30H27N5O7S2/c1-20(2)33(19-21-7-5-4-6-8-21)44(39,40)25-13-9-22(10-14-25)29(36)34(31-18-24-12-16-28(42-24)35(37)38)30-32-26-15-11-23(41-3)17-27(26)43-30/h4-18,20H,19H2,1-3H3/b31-18+ |
| InChIKey | PWWCDDXDUDIDPS-FDAWAROLSA-N |
| XLogP | 6.09 |
| TPSA | 148.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.71 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|