C33H32N4O7S2 — CID 44945473
4-[benzyl(methyl)sulfamoyl]-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide (PubChem CID 44945473) has the molecular formula C33H32N4O7S2 and a molecular weight of 660.77 g/mol. Its IUPAC name is 4-[benzyl(methyl)sulfamoyl]-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-[benzyl(methyl)sulfamoyl]-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44945473 |
| Molecular Formula | C33H32N4O7S2 |
| Molecular Weight | 660.77 g/mol |
| Exact Mass | 660.17 |
| IUPAC Name | 4-[benzyl(methyl)sulfamoyl]-N-(6-methoxy-1,3-benzothiazol-2-yl)-N-[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1ccc2nc(N(/N=C/c3cc(OC)c(OC)c(OC)c3)C(=O)c3ccc(S(=O)(=O)N(C)Cc4ccccc4)cc3)sc2c1 |
| InChI | InChI=1S/C33H32N4O7S2/c1-36(21-22-9-7-6-8-10-22)46(39,40)26-14-11-24(12-15-26)32(38)37(33-35-27-16-13-25(41-2)19-30(27)45-33)34-20-23-17-28(42-3)31(44-5)29(18-23)43-4/h6-20H,21H2,1-5H3/b34-20+ |
| InChIKey | VOGSSGYMFKWQJL-QXUDOOCXSA-N |
| XLogP | 5.83 |
| TPSA | 119.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.77 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|