C30H25FN4O4S2 — CID 44943592
4-[benzyl(methyl)sulfamoyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide (PubChem CID 44943592) has the molecular formula C30H25FN4O4S2 and a molecular weight of 588.69 g/mol. Its IUPAC name is 4-[benzyl(methyl)sulfamoyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-[benzyl(methyl)sulfamoyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 44943592 |
| Molecular Formula | C30H25FN4O4S2 |
| Molecular Weight | 588.69 g/mol |
| Exact Mass | 588.13 |
| IUPAC Name | 4-[benzyl(methyl)sulfamoyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-(4-methoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1ccc(/C=N/N(C(=O)c2ccc(S(=O)(=O)N(C)Cc3ccccc3)cc2)c2nc3ccc(F)cc3s2)cc1 |
| InChI | InChI=1S/C30H25FN4O4S2/c1-34(20-22-6-4-3-5-7-22)41(37,38)26-15-10-23(11-16-26)29(36)35(32-19-21-8-13-25(39-2)14-9-21)30-33-27-17-12-24(31)18-28(27)40-30/h3-19H,20H2,1-2H3/b32-19+ |
| InChIKey | WJQXZKYUUCYIKW-BIZUNTBRSA-N |
| XLogP | 5.95 |
| TPSA | 92.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.69 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|