C28H23FN4O3S3 — CID 44943213
4-[benzyl(ethyl)sulfamoyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-thiophen-2-ylmethylideneamino]benzamide (PubChem CID 44943213) has the molecular formula C28H23FN4O3S3 and a molecular weight of 578.72 g/mol. Its IUPAC name is 4-[benzyl(ethyl)sulfamoyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-thiophen-2-ylmethylideneamino]benzamide.
| Compound Name | 4-[benzyl(ethyl)sulfamoyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-thiophen-2-ylmethylideneamino]benzamide |
|---|---|
| PubChem CID | 44943213 |
| Molecular Formula | C28H23FN4O3S3 |
| Molecular Weight | 578.72 g/mol |
| Exact Mass | 578.09 |
| IUPAC Name | 4-[benzyl(ethyl)sulfamoyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(E)-thiophen-2-ylmethylideneamino]benzamide |
| SMILES | CCN(Cc1ccccc1)S(=O)(=O)c1ccc(C(=O)N(/N=C/c2cccs2)c2nc3ccc(F)cc3s2)cc1 |
| InChI | InChI=1S/C28H23FN4O3S3/c1-2-32(19-20-7-4-3-5-8-20)39(35,36)24-13-10-21(11-14-24)27(34)33(30-18-23-9-6-16-37-23)28-31-25-15-12-22(29)17-26(25)38-28/h3-18H,2,19H2,1H3/b30-18+ |
| InChIKey | FTFFYMLBWQWQCN-UXHLAJHPSA-N |
| XLogP | 6.39 |
| TPSA | 82.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.72 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|