C17H10FN3OS3 — CID 7543484
N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(Z)-thiophen-2-ylmethylideneamino]thiophene-2-carboxamide (PubChem CID 7543484) has the molecular formula C17H10FN3OS3 and a molecular weight of 387.49 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(Z)-thiophen-2-ylmethylideneamino]thiophene-2-carboxamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(Z)-thiophen-2-ylmethylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 7543484 |
| Molecular Formula | C17H10FN3OS3 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.00 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-[(Z)-thiophen-2-ylmethylideneamino]thiophene-2-carboxamide |
| SMILES | O=C(c1cccs1)N(/N=C\c1cccs1)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C17H10FN3OS3/c18-11-5-6-13-15(9-11)25-17(20-13)21(16(22)14-4-2-8-24-14)19-10-12-3-1-7-23-12/h1-10H/b19-10- |
| InChIKey | KSXVGDNANQUNHV-GRSHGNNSSA-N |
| XLogP | 5.24 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|