C21H13FN4O3S2 — CID 44943160
(E)-N-(6-fluoro-1,3-benzothiazol-2-yl)-3-(3-nitrophenyl)-N-[(E)-thiophen-2-ylmethylideneamino]prop-2-enamide (PubChem CID 44943160) has the molecular formula C21H13FN4O3S2 and a molecular weight of 452.49 g/mol. Its IUPAC name is (E)-N-(6-fluoro-1,3-benzothiazol-2-yl)-3-(3-nitrophenyl)-N-[(E)-thiophen-2-ylmethylideneamino]prop-2-enamide.
| Compound Name | (E)-N-(6-fluoro-1,3-benzothiazol-2-yl)-3-(3-nitrophenyl)-N-[(E)-thiophen-2-ylmethylideneamino]prop-2-enamide |
|---|---|
| PubChem CID | 44943160 |
| Molecular Formula | C21H13FN4O3S2 |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | (E)-N-(6-fluoro-1,3-benzothiazol-2-yl)-3-(3-nitrophenyl)-N-[(E)-thiophen-2-ylmethylideneamino]prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc([N+](=O)[O-])c1)N(/N=C/c1cccs1)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C21H13FN4O3S2/c22-15-7-8-18-19(12-15)31-21(24-18)25(23-13-17-5-2-10-30-17)20(27)9-6-14-3-1-4-16(11-14)26(28)29/h1-13H/b9-6+,23-13+ |
| InChIKey | RRNSUCZYSAMCFT-QJYQRYIGSA-N |
| XLogP | 5.49 |
| TPSA | 88.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|