C20H15N3OS3 — CID 8609233
(E)-N-(6-methyl-1,3-benzothiazol-2-yl)-3-thiophen-2-yl-N-[(Z)-thiophen-2-ylmethylideneamino]prop-2-enamide (PubChem CID 8609233) has the molecular formula C20H15N3OS3 and a molecular weight of 409.56 g/mol. Its IUPAC name is (E)-N-(6-methyl-1,3-benzothiazol-2-yl)-3-thiophen-2-yl-N-[(Z)-thiophen-2-ylmethylideneamino]prop-2-enamide.
| Compound Name | (E)-N-(6-methyl-1,3-benzothiazol-2-yl)-3-thiophen-2-yl-N-[(Z)-thiophen-2-ylmethylideneamino]prop-2-enamide |
|---|---|
| PubChem CID | 8609233 |
| Molecular Formula | C20H15N3OS3 |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | (E)-N-(6-methyl-1,3-benzothiazol-2-yl)-3-thiophen-2-yl-N-[(Z)-thiophen-2-ylmethylideneamino]prop-2-enamide |
| SMILES | Cc1ccc2nc(N(/N=C\c3cccs3)C(=O)/C=C/c3cccs3)sc2c1 |
| InChI | InChI=1S/C20H15N3OS3/c1-14-6-8-17-18(12-14)27-20(22-17)23(21-13-16-5-3-11-26-16)19(24)9-7-15-4-2-10-25-15/h2-13H,1H3/b9-7+,21-13- |
| InChIKey | JZQWKWQTVHTMSJ-ZOYVTTDVSA-N |
| XLogP | 5.81 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|