C19H22N3OS2+ — CID 7207995
dimethyl-[2-[(6-methyl-1,3-benzothiazol-2-yl)-[(E)-3-thiophen-2-ylprop-2-enoyl]amino]ethyl]azanium (PubChem CID 7207995) has the molecular formula C19H22N3OS2+ and a molecular weight of 372.54 g/mol. Its IUPAC name is dimethyl-[2-[(6-methyl-1,3-benzothiazol-2-yl)-[(E)-3-thiophen-2-ylprop-2-enoyl]amino]ethyl]azanium.
| Compound Name | dimethyl-[2-[(6-methyl-1,3-benzothiazol-2-yl)-[(E)-3-thiophen-2-ylprop-2-enoyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 7207995 |
| Molecular Formula | C19H22N3OS2+ |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | dimethyl-[2-[(6-methyl-1,3-benzothiazol-2-yl)-[(E)-3-thiophen-2-ylprop-2-enoyl]amino]ethyl]azanium |
| SMILES | Cc1ccc2nc(N(CC[NH+](C)C)C(=O)/C=C/c3cccs3)sc2c1 |
| InChI | InChI=1S/C19H21N3OS2/c1-14-6-8-16-17(13-14)25-19(20-16)22(11-10-21(2)3)18(23)9-7-15-5-4-12-24-15/h4-9,12-13H,10-11H2,1-3H3/p+1/b9-7+ |
| InChIKey | BIOPPQFYVIWKKL-VQHVLOKHSA-O |
| XLogP | 2.86 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|