C20H23ClN3OS2+ — CID 7511400
2-[(6-chloro-1,3-benzothiazol-2-yl)-[(E)-3-thiophen-2-ylprop-2-enoyl]amino]ethyl-diethylazanium (PubChem CID 7511400) has the molecular formula C20H23ClN3OS2+ and a molecular weight of 421.01 g/mol. Its IUPAC name is 2-[(6-chloro-1,3-benzothiazol-2-yl)-[(E)-3-thiophen-2-ylprop-2-enoyl]amino]ethyl-diethylazanium.
| Compound Name | 2-[(6-chloro-1,3-benzothiazol-2-yl)-[(E)-3-thiophen-2-ylprop-2-enoyl]amino]ethyl-diethylazanium |
|---|---|
| PubChem CID | 7511400 |
| Molecular Formula | C20H23ClN3OS2+ |
| Molecular Weight | 421.01 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 2-[(6-chloro-1,3-benzothiazol-2-yl)-[(E)-3-thiophen-2-ylprop-2-enoyl]amino]ethyl-diethylazanium |
| SMILES | CC[NH+](CC)CCN(C(=O)/C=C/c1cccs1)c1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C20H22ClN3OS2/c1-3-23(4-2)11-12-24(19(25)10-8-16-6-5-13-26-16)20-22-17-9-7-15(21)14-18(17)27-20/h5-10,13-14H,3-4,11-12H2,1-2H3/p+1/b10-8+ |
| InChIKey | GROQKLBZGVOENP-CSKARUKUSA-O |
| XLogP | 3.98 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.01 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|