C21H15ClN2OS2 — CID 41110374
(E)-N-benzyl-N-(6-chloro-1,3-benzothiazol-2-yl)-3-thiophen-2-ylprop-2-enamide (PubChem CID 41110374) has the molecular formula C21H15ClN2OS2 and a molecular weight of 410.95 g/mol. Its IUPAC name is (E)-N-benzyl-N-(6-chloro-1,3-benzothiazol-2-yl)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-benzyl-N-(6-chloro-1,3-benzothiazol-2-yl)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 41110374 |
| Molecular Formula | C21H15ClN2OS2 |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | (E)-N-benzyl-N-(6-chloro-1,3-benzothiazol-2-yl)-3-thiophen-2-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccs1)N(Cc1ccccc1)c1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C21H15ClN2OS2/c22-16-8-10-18-19(13-16)27-21(23-18)24(14-15-5-2-1-3-6-15)20(25)11-9-17-7-4-12-26-17/h1-13H,14H2/b11-9+ |
| InChIKey | FQUIHFYPHZGXOB-PKNBQFBNSA-N |
| XLogP | 6.26 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|