C21H15N3O3S2 — CID 18572567
(E)-N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-N-(pyridin-3-ylmethyl)-3-thiophen-2-ylprop-2-enamide (PubChem CID 18572567) has the molecular formula C21H15N3O3S2 and a molecular weight of 421.50 g/mol. Its IUPAC name is (E)-N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-N-(pyridin-3-ylmethyl)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-N-(pyridin-3-ylmethyl)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 18572567 |
| Molecular Formula | C21H15N3O3S2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | (E)-N-([1,3]dioxolo[4,5-f][1,3]benzothiazol-6-yl)-N-(pyridin-3-ylmethyl)-3-thiophen-2-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccs1)N(Cc1cccnc1)c1nc2cc3c(cc2s1)OCO3 |
| InChI | InChI=1S/C21H15N3O3S2/c25-20(6-5-15-4-2-8-28-15)24(12-14-3-1-7-22-11-14)21-23-16-9-17-18(27-13-26-17)10-19(16)29-21/h1-11H,12-13H2/b6-5+ |
| InChIKey | QEFDBUXBOWPWNN-AATRIKPKSA-N |
| XLogP | 4.73 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|