C20H22BrN3OS2 — CID 41345262
(E)-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 41345262) has the molecular formula C20H22BrN3OS2 and a molecular weight of 464.45 g/mol. Its IUPAC name is (E)-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 41345262 |
| Molecular Formula | C20H22BrN3OS2 |
| Molecular Weight | 464.45 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | (E)-N-(6-bromo-1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | CCN(CC)CCN(C(=O)/C=C/c1cccs1)c1nc2ccc(Br)cc2s1 |
| InChI | InChI=1S/C20H22BrN3OS2/c1-3-23(4-2)11-12-24(19(25)10-8-16-6-5-13-26-16)20-22-17-9-7-15(21)14-18(17)27-20/h5-10,13-14H,3-4,11-12H2,1-2H3/b10-8+ |
| InChIKey | HBUXDBZMRRQNSI-CSKARUKUSA-N |
| XLogP | 5.51 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.45 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|