C23H27N3OS2 — CID 74769059
N-[2-(diethylamino)ethyl]-N-(6-methylsulfanyl-1,3-benzothiazol-2-yl)-3-phenylprop-2-enamide (PubChem CID 74769059) has the molecular formula C23H27N3OS2 and a molecular weight of 425.62 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-(6-methylsulfanyl-1,3-benzothiazol-2-yl)-3-phenylprop-2-enamide.
| Compound Name | N-[2-(diethylamino)ethyl]-N-(6-methylsulfanyl-1,3-benzothiazol-2-yl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 74769059 |
| Molecular Formula | C23H27N3OS2 |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-(6-methylsulfanyl-1,3-benzothiazol-2-yl)-3-phenylprop-2-enamide |
| SMILES | CCN(CC)CCN(C(=O)C=Cc1ccccc1)c1nc2ccc(SC)cc2s1 |
| InChI | InChI=1S/C23H27N3OS2/c1-4-25(5-2)15-16-26(22(27)14-11-18-9-7-6-8-10-18)23-24-20-13-12-19(28-3)17-21(20)29-23/h6-14,17H,4-5,15-16H2,1-3H3 |
| InChIKey | SXJAYLYHKDRSAV-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|