C24H32ClN3OS3 — CID 44947446
N-[2-(diethylamino)ethyl]-N-(6-methylsulfanyl-1,3-benzothiazol-2-yl)-4-phenylsulfanylbutanamide;hydrochloride (PubChem CID 44947446) has the molecular formula C24H32ClN3OS3 and a molecular weight of 510.19 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-(6-methylsulfanyl-1,3-benzothiazol-2-yl)-4-phenylsulfanylbutanamide;hydrochloride.
| Compound Name | N-[2-(diethylamino)ethyl]-N-(6-methylsulfanyl-1,3-benzothiazol-2-yl)-4-phenylsulfanylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 44947446 |
| Molecular Formula | C24H32ClN3OS3 |
| Molecular Weight | 510.19 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-(6-methylsulfanyl-1,3-benzothiazol-2-yl)-4-phenylsulfanylbutanamide;hydrochloride |
| SMILES | CCN(CC)CCN(C(=O)CCCSc1ccccc1)c1nc2ccc(SC)cc2s1.Cl |
| InChI | InChI=1S/C24H31N3OS3.ClH/c1-4-26(5-2)15-16-27(23(28)12-9-17-30-19-10-7-6-8-11-19)24-25-21-14-13-20(29-3)18-22(21)31-24;/h6-8,10-11,13-14,18H,4-5,9,12,15-17H2,1-3H3;1H |
| InChIKey | HUHIHJIILYPXDK-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.19 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|