C24H32ClN3OS2 — CID 44937441
N-[2-(diethylamino)ethyl]-N-(4-methyl-1,3-benzothiazol-2-yl)-4-phenylsulfanylbutanamide;hydrochloride (PubChem CID 44937441) has the molecular formula C24H32ClN3OS2 and a molecular weight of 478.13 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-(4-methyl-1,3-benzothiazol-2-yl)-4-phenylsulfanylbutanamide;hydrochloride.
| Compound Name | N-[2-(diethylamino)ethyl]-N-(4-methyl-1,3-benzothiazol-2-yl)-4-phenylsulfanylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 44937441 |
| Molecular Formula | C24H32ClN3OS2 |
| Molecular Weight | 478.13 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-(4-methyl-1,3-benzothiazol-2-yl)-4-phenylsulfanylbutanamide;hydrochloride |
| SMILES | CCN(CC)CCN(C(=O)CCCSc1ccccc1)c1nc2c(C)cccc2s1.Cl |
| InChI | InChI=1S/C24H31N3OS2.ClH/c1-4-26(5-2)16-17-27(24-25-23-19(3)11-9-14-21(23)30-24)22(28)15-10-18-29-20-12-7-6-8-13-20;/h6-9,11-14H,4-5,10,15-18H2,1-3H3;1H |
| InChIKey | BLONORWPMASJQC-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.13 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|