C26H36ClN3O2S2 — CID 44937642
N-[2-(diethylamino)ethyl]-N-(4-ethyl-1,3-benzothiazol-2-yl)-4-(4-methoxyphenyl)sulfanylbutanamide;hydrochloride (PubChem CID 44937642) has the molecular formula C26H36ClN3O2S2 and a molecular weight of 522.18 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-(4-ethyl-1,3-benzothiazol-2-yl)-4-(4-methoxyphenyl)sulfanylbutanamide;hydrochloride.
| Compound Name | N-[2-(diethylamino)ethyl]-N-(4-ethyl-1,3-benzothiazol-2-yl)-4-(4-methoxyphenyl)sulfanylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 44937642 |
| Molecular Formula | C26H36ClN3O2S2 |
| Molecular Weight | 522.18 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-(4-ethyl-1,3-benzothiazol-2-yl)-4-(4-methoxyphenyl)sulfanylbutanamide;hydrochloride |
| SMILES | CCc1cccc2sc(N(CCN(CC)CC)C(=O)CCCSc3ccc(OC)cc3)nc12.Cl |
| InChI | InChI=1S/C26H35N3O2S2.ClH/c1-5-20-10-8-11-23-25(20)27-26(33-23)29(18-17-28(6-2)7-3)24(30)12-9-19-32-22-15-13-21(31-4)14-16-22;/h8,10-11,13-16H,5-7,9,12,17-19H2,1-4H3;1H |
| InChIKey | XQCYGFLBOBRQAB-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.18 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|