C25H33N3O3S2 — CID 41085454
N-[2-(diethylamino)ethyl]-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-4-phenylsulfanylbutanamide (PubChem CID 41085454) has the molecular formula C25H33N3O3S2 and a molecular weight of 487.69 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-4-phenylsulfanylbutanamide.
| Compound Name | N-[2-(diethylamino)ethyl]-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-4-phenylsulfanylbutanamide |
|---|---|
| PubChem CID | 41085454 |
| Molecular Formula | C25H33N3O3S2 |
| Molecular Weight | 487.69 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-4-phenylsulfanylbutanamide |
| SMILES | CCN(CC)CCN(C(=O)CCCSc1ccccc1)c1nc2c(OC)ccc(OC)c2s1 |
| InChI | InChI=1S/C25H33N3O3S2/c1-5-27(6-2)16-17-28(22(29)13-10-18-32-19-11-8-7-9-12-19)25-26-23-20(30-3)14-15-21(31-4)24(23)33-25/h7-9,11-12,14-15H,5-6,10,13,16-18H2,1-4H3 |
| InChIKey | LAFWHIKATRHTPN-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.69 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|