C26H27N3O2S2 — CID 41318836
N-(4-ethyl-1,3-benzothiazol-2-yl)-4-(4-methoxyphenyl)sulfanyl-N-(pyridin-3-ylmethyl)butanamide (PubChem CID 41318836) has the molecular formula C26H27N3O2S2 and a molecular weight of 477.66 g/mol. Its IUPAC name is N-(4-ethyl-1,3-benzothiazol-2-yl)-4-(4-methoxyphenyl)sulfanyl-N-(pyridin-3-ylmethyl)butanamide.
| Compound Name | N-(4-ethyl-1,3-benzothiazol-2-yl)-4-(4-methoxyphenyl)sulfanyl-N-(pyridin-3-ylmethyl)butanamide |
|---|---|
| PubChem CID | 41318836 |
| Molecular Formula | C26H27N3O2S2 |
| Molecular Weight | 477.66 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | N-(4-ethyl-1,3-benzothiazol-2-yl)-4-(4-methoxyphenyl)sulfanyl-N-(pyridin-3-ylmethyl)butanamide |
| SMILES | CCc1cccc2sc(N(Cc3cccnc3)C(=O)CCCSc3ccc(OC)cc3)nc12 |
| InChI | InChI=1S/C26H27N3O2S2/c1-3-20-8-4-9-23-25(20)28-26(33-23)29(18-19-7-5-15-27-17-19)24(30)10-6-16-32-22-13-11-21(31-2)12-14-22/h4-5,7-9,11-15,17H,3,6,10,16,18H2,1-2H3 |
| InChIKey | OCUWGRSKKUNPCQ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.66 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|