C25H25N3O2S2 — CID 41319211
N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-4-phenylsulfanyl-N-(pyridin-3-ylmethyl)butanamide (PubChem CID 41319211) has the molecular formula C25H25N3O2S2 and a molecular weight of 463.63 g/mol. Its IUPAC name is N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-4-phenylsulfanyl-N-(pyridin-3-ylmethyl)butanamide.
| Compound Name | N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-4-phenylsulfanyl-N-(pyridin-3-ylmethyl)butanamide |
|---|---|
| PubChem CID | 41319211 |
| Molecular Formula | C25H25N3O2S2 |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-4-phenylsulfanyl-N-(pyridin-3-ylmethyl)butanamide |
| SMILES | COc1ccc(C)c2sc(N(Cc3cccnc3)C(=O)CCCSc3ccccc3)nc12 |
| InChI | InChI=1S/C25H25N3O2S2/c1-18-12-13-21(30-2)23-24(18)32-25(27-23)28(17-19-8-6-14-26-16-19)22(29)11-7-15-31-20-9-4-3-5-10-20/h3-6,8-10,12-14,16H,7,11,15,17H2,1-2H3 |
| InChIKey | DQZWTVRDCXPRKJ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|