C24H22ClN3O2S2 — CID 43994729
N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-4-phenylsulfanyl-N-(pyridin-4-ylmethyl)butanamide (PubChem CID 43994729) has the molecular formula C24H22ClN3O2S2 and a molecular weight of 484.05 g/mol. Its IUPAC name is N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-4-phenylsulfanyl-N-(pyridin-4-ylmethyl)butanamide.
| Compound Name | N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-4-phenylsulfanyl-N-(pyridin-4-ylmethyl)butanamide |
|---|---|
| PubChem CID | 43994729 |
| Molecular Formula | C24H22ClN3O2S2 |
| Molecular Weight | 484.05 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-4-phenylsulfanyl-N-(pyridin-4-ylmethyl)butanamide |
| SMILES | COc1ccc(Cl)c2sc(N(Cc3ccncc3)C(=O)CCCSc3ccccc3)nc12 |
| InChI | InChI=1S/C24H22ClN3O2S2/c1-30-20-10-9-19(25)23-22(20)27-24(32-23)28(16-17-11-13-26-14-12-17)21(29)8-5-15-31-18-6-3-2-4-7-18/h2-4,6-7,9-14H,5,8,15-16H2,1H3 |
| InChIKey | WAYAXRYBVXXJDN-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.05 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|