C26H27N3OS2 — CID 41319152
N-(5,7-dimethyl-1,3-benzothiazol-2-yl)-4-(4-methylphenyl)sulfanyl-N-(pyridin-3-ylmethyl)butanamide (PubChem CID 41319152) has the molecular formula C26H27N3OS2 and a molecular weight of 461.66 g/mol. Its IUPAC name is N-(5,7-dimethyl-1,3-benzothiazol-2-yl)-4-(4-methylphenyl)sulfanyl-N-(pyridin-3-ylmethyl)butanamide.
| Compound Name | N-(5,7-dimethyl-1,3-benzothiazol-2-yl)-4-(4-methylphenyl)sulfanyl-N-(pyridin-3-ylmethyl)butanamide |
|---|---|
| PubChem CID | 41319152 |
| Molecular Formula | C26H27N3OS2 |
| Molecular Weight | 461.66 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | N-(5,7-dimethyl-1,3-benzothiazol-2-yl)-4-(4-methylphenyl)sulfanyl-N-(pyridin-3-ylmethyl)butanamide |
| SMILES | Cc1ccc(SCCCC(=O)N(Cc2cccnc2)c2nc3cc(C)cc(C)c3s2)cc1 |
| InChI | InChI=1S/C26H27N3OS2/c1-18-8-10-22(11-9-18)31-13-5-7-24(30)29(17-21-6-4-12-27-16-21)26-28-23-15-19(2)14-20(3)25(23)32-26/h4,6,8-12,14-16H,5,7,13,17H2,1-3H3 |
| InChIKey | JAFCTYFPTQEJOH-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.66 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|