C25H25N3OS2 — CID 41319173
N-(4,7-dimethyl-1,3-benzothiazol-2-yl)-4-phenylsulfanyl-N-(pyridin-3-ylmethyl)butanamide (PubChem CID 41319173) has the molecular formula C25H25N3OS2 and a molecular weight of 447.63 g/mol. Its IUPAC name is N-(4,7-dimethyl-1,3-benzothiazol-2-yl)-4-phenylsulfanyl-N-(pyridin-3-ylmethyl)butanamide.
| Compound Name | N-(4,7-dimethyl-1,3-benzothiazol-2-yl)-4-phenylsulfanyl-N-(pyridin-3-ylmethyl)butanamide |
|---|---|
| PubChem CID | 41319173 |
| Molecular Formula | C25H25N3OS2 |
| Molecular Weight | 447.63 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | N-(4,7-dimethyl-1,3-benzothiazol-2-yl)-4-phenylsulfanyl-N-(pyridin-3-ylmethyl)butanamide |
| SMILES | Cc1ccc(C)c2sc(N(Cc3cccnc3)C(=O)CCCSc3ccccc3)nc12 |
| InChI | InChI=1S/C25H25N3OS2/c1-18-12-13-19(2)24-23(18)27-25(31-24)28(17-20-8-6-14-26-16-20)22(29)11-7-15-30-21-9-4-3-5-10-21/h3-6,8-10,12-14,16H,7,11,15,17H2,1-2H3 |
| InChIKey | JOVBGAUUUMUNIB-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.63 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|