C23H19ClFN3OS2 — CID 41318923
4-(4-chlorophenyl)sulfanyl-N-(4-fluoro-1,3-benzothiazol-2-yl)-N-(pyridin-3-ylmethyl)butanamide (PubChem CID 41318923) has the molecular formula C23H19ClFN3OS2 and a molecular weight of 472.01 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-N-(4-fluoro-1,3-benzothiazol-2-yl)-N-(pyridin-3-ylmethyl)butanamide.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-N-(4-fluoro-1,3-benzothiazol-2-yl)-N-(pyridin-3-ylmethyl)butanamide |
|---|---|
| PubChem CID | 41318923 |
| Molecular Formula | C23H19ClFN3OS2 |
| Molecular Weight | 472.01 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-N-(4-fluoro-1,3-benzothiazol-2-yl)-N-(pyridin-3-ylmethyl)butanamide |
| SMILES | O=C(CCCSc1ccc(Cl)cc1)N(Cc1cccnc1)c1nc2c(F)cccc2s1 |
| InChI | InChI=1S/C23H19ClFN3OS2/c24-17-8-10-18(11-9-17)30-13-3-7-21(29)28(15-16-4-2-12-26-14-16)23-27-22-19(25)5-1-6-20(22)31-23/h1-2,4-6,8-12,14H,3,7,13,15H2 |
| InChIKey | OFYVTFKPJOMIPX-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.01 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|