C23H30ClN3OS2 — CID 44937443
N-[2-(dimethylamino)ethyl]-N-(4-ethyl-1,3-benzothiazol-2-yl)-4-phenylsulfanylbutanamide;hydrochloride (PubChem CID 44937443) has the molecular formula C23H30ClN3OS2 and a molecular weight of 464.10 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-(4-ethyl-1,3-benzothiazol-2-yl)-4-phenylsulfanylbutanamide;hydrochloride.
| Compound Name | N-[2-(dimethylamino)ethyl]-N-(4-ethyl-1,3-benzothiazol-2-yl)-4-phenylsulfanylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 44937443 |
| Molecular Formula | C23H30ClN3OS2 |
| Molecular Weight | 464.10 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-(4-ethyl-1,3-benzothiazol-2-yl)-4-phenylsulfanylbutanamide;hydrochloride |
| SMILES | CCc1cccc2sc(N(CCN(C)C)C(=O)CCCSc3ccccc3)nc12.Cl |
| InChI | InChI=1S/C23H29N3OS2.ClH/c1-4-18-10-8-13-20-22(18)24-23(29-20)26(16-15-25(2)3)21(27)14-9-17-28-19-11-6-5-7-12-19;/h5-8,10-13H,4,9,14-17H2,1-3H3;1H |
| InChIKey | MCCWZMUOBAWJSN-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.10 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|