C23H29N3OS2 — CID 41085561
N-[2-(dimethylamino)ethyl]-N-(4-methyl-1,3-benzothiazol-2-yl)-4-(4-methylphenyl)sulfanylbutanamide (PubChem CID 41085561) has the molecular formula C23H29N3OS2 and a molecular weight of 427.64 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-(4-methyl-1,3-benzothiazol-2-yl)-4-(4-methylphenyl)sulfanylbutanamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N-(4-methyl-1,3-benzothiazol-2-yl)-4-(4-methylphenyl)sulfanylbutanamide |
|---|---|
| PubChem CID | 41085561 |
| Molecular Formula | C23H29N3OS2 |
| Molecular Weight | 427.64 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-(4-methyl-1,3-benzothiazol-2-yl)-4-(4-methylphenyl)sulfanylbutanamide |
| SMILES | Cc1ccc(SCCCC(=O)N(CCN(C)C)c2nc3c(C)cccc3s2)cc1 |
| InChI | InChI=1S/C23H29N3OS2/c1-17-10-12-19(13-11-17)28-16-6-9-21(27)26(15-14-25(3)4)23-24-22-18(2)7-5-8-20(22)29-23/h5,7-8,10-13H,6,9,14-16H2,1-4H3 |
| InChIKey | JBUYILNGRPOGFF-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.64 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|