C21H23F2N3OS2 — CID 41086787
N-[2-(dimethylamino)ethyl]-N-(4-fluoro-1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)sulfanylbutanamide (PubChem CID 41086787) has the molecular formula C21H23F2N3OS2 and a molecular weight of 435.57 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-(4-fluoro-1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)sulfanylbutanamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N-(4-fluoro-1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)sulfanylbutanamide |
|---|---|
| PubChem CID | 41086787 |
| Molecular Formula | C21H23F2N3OS2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-(4-fluoro-1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)sulfanylbutanamide |
| SMILES | CN(C)CCN(C(=O)CCCSc1ccc(F)cc1)c1nc2c(F)cccc2s1 |
| InChI | InChI=1S/C21H23F2N3OS2/c1-25(2)12-13-26(21-24-20-17(23)5-3-6-18(20)29-21)19(27)7-4-14-28-16-10-8-15(22)9-11-16/h3,5-6,8-11H,4,7,12-14H2,1-2H3 |
| InChIKey | LPAMUQIRWZXOSI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|