C24H31ClN4O3S2 — CID 44937537
N-[2-(diethylamino)ethyl]-4-(4-methylphenyl)sulfanyl-N-(6-nitro-1,3-benzothiazol-2-yl)butanamide;hydrochloride (PubChem CID 44937537) has the molecular formula C24H31ClN4O3S2 and a molecular weight of 523.12 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-4-(4-methylphenyl)sulfanyl-N-(6-nitro-1,3-benzothiazol-2-yl)butanamide;hydrochloride.
| Compound Name | N-[2-(diethylamino)ethyl]-4-(4-methylphenyl)sulfanyl-N-(6-nitro-1,3-benzothiazol-2-yl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 44937537 |
| Molecular Formula | C24H31ClN4O3S2 |
| Molecular Weight | 523.12 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-4-(4-methylphenyl)sulfanyl-N-(6-nitro-1,3-benzothiazol-2-yl)butanamide;hydrochloride |
| SMILES | CCN(CC)CCN(C(=O)CCCSc1ccc(C)cc1)c1nc2ccc([N+](=O)[O-])cc2s1.Cl |
| InChI | InChI=1S/C24H30N4O3S2.ClH/c1-4-26(5-2)14-15-27(23(29)7-6-16-32-20-11-8-18(3)9-12-20)24-25-21-13-10-19(28(30)31)17-22(21)33-24;/h8-13,17H,4-7,14-16H2,1-3H3;1H |
| InChIKey | WJUBIBYKSNUFGS-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.12 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|