C21H22ClN3OS — CID 74757659
N-(6-chloro-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-3-phenylprop-2-enamide (PubChem CID 74757659) has the molecular formula C21H22ClN3OS and a molecular weight of 399.95 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-3-phenylprop-2-enamide.
| Compound Name | N-(6-chloro-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 74757659 |
| Molecular Formula | C21H22ClN3OS |
| Molecular Weight | 399.95 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | N-(6-chloro-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-3-phenylprop-2-enamide |
| SMILES | CN(C)CCCN(C(=O)C=Cc1ccccc1)c1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C21H22ClN3OS/c1-24(2)13-6-14-25(20(26)12-9-16-7-4-3-5-8-16)21-23-18-11-10-17(22)15-19(18)27-21/h3-5,7-12,15H,6,13-14H2,1-2H3 |
| InChIKey | GFONEJKYLZQVSO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.95 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|