C20H20ClN3OS — CID 7510477
(E)-N-(4-chloro-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-3-phenylprop-2-enamide (PubChem CID 7510477) has the molecular formula C20H20ClN3OS and a molecular weight of 385.92 g/mol. Its IUPAC name is (E)-N-(4-chloro-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-(4-chloro-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 7510477 |
| Molecular Formula | C20H20ClN3OS |
| Molecular Weight | 385.92 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | (E)-N-(4-chloro-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-3-phenylprop-2-enamide |
| SMILES | CN(C)CCN(C(=O)/C=C/c1ccccc1)c1nc2c(Cl)cccc2s1 |
| InChI | InChI=1S/C20H20ClN3OS/c1-23(2)13-14-24(18(25)12-11-15-7-4-3-5-8-15)20-22-19-16(21)9-6-10-17(19)26-20/h3-12H,13-14H2,1-2H3/b12-11+ |
| InChIKey | MCLHGKOIGKAXOZ-VAWYXSNFSA-N |
| XLogP | 4.56 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.92 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|