C20H19ClN4O3S — CID 74757507
N-(4-chloro-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 74757507) has the molecular formula C20H19ClN4O3S and a molecular weight of 430.92 g/mol. Its IUPAC name is N-(4-chloro-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | N-(4-chloro-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 74757507 |
| Molecular Formula | C20H19ClN4O3S |
| Molecular Weight | 430.92 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | N-(4-chloro-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | CN(C)CCN(C(=O)C=Cc1cccc([N+](=O)[O-])c1)c1nc2c(Cl)cccc2s1 |
| InChI | InChI=1S/C20H19ClN4O3S/c1-23(2)11-12-24(20-22-19-16(21)7-4-8-17(19)29-20)18(26)10-9-14-5-3-6-15(13-14)25(27)28/h3-10,13H,11-12H2,1-2H3 |
| InChIKey | CGFCIILWCBLOTC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.92 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|