C20H19Cl2N3OS — CID 74757509
N-(4-chloro-1,3-benzothiazol-2-yl)-3-(2-chlorophenyl)-N-[2-(dimethylamino)ethyl]prop-2-enamide (PubChem CID 74757509) has the molecular formula C20H19Cl2N3OS and a molecular weight of 420.37 g/mol. Its IUPAC name is N-(4-chloro-1,3-benzothiazol-2-yl)-3-(2-chlorophenyl)-N-[2-(dimethylamino)ethyl]prop-2-enamide.
| Compound Name | N-(4-chloro-1,3-benzothiazol-2-yl)-3-(2-chlorophenyl)-N-[2-(dimethylamino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 74757509 |
| Molecular Formula | C20H19Cl2N3OS |
| Molecular Weight | 420.37 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | N-(4-chloro-1,3-benzothiazol-2-yl)-3-(2-chlorophenyl)-N-[2-(dimethylamino)ethyl]prop-2-enamide |
| SMILES | CN(C)CCN(C(=O)C=Cc1ccccc1Cl)c1nc2c(Cl)cccc2s1 |
| InChI | InChI=1S/C20H19Cl2N3OS/c1-24(2)12-13-25(18(26)11-10-14-6-3-4-7-15(14)21)20-23-19-16(22)8-5-9-17(19)27-20/h3-11H,12-13H2,1-2H3 |
| InChIKey | VMHQKFXNPIFNGR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.37 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|