C23H24ClN3O4S2 — CID 29278125
(E)-3-(2-chlorophenyl)-N-(4-methylsulfonyl-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)prop-2-enamide (PubChem CID 29278125) has the molecular formula C23H24ClN3O4S2 and a molecular weight of 506.05 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-(4-methylsulfonyl-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-(4-methylsulfonyl-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 29278125 |
| Molecular Formula | C23H24ClN3O4S2 |
| Molecular Weight | 506.05 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-(4-methylsulfonyl-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)prop-2-enamide |
| SMILES | CS(=O)(=O)c1cccc2sc(N(CCN3CCOCC3)C(=O)/C=C/c3ccccc3Cl)nc12 |
| InChI | InChI=1S/C23H24ClN3O4S2/c1-33(29,30)20-8-4-7-19-22(20)25-23(32-19)27(12-11-26-13-15-31-16-14-26)21(28)10-9-17-5-2-3-6-18(17)24/h2-10H,11-16H2,1H3/b10-9+ |
| InChIKey | BWVMQVXJUYCEFF-MDZDMXLPSA-N |
| XLogP | 3.73 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.05 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|