C21H16Cl2N4OS — CID 30460762
(E)-N-(4-chloro-1,3-benzothiazol-2-yl)-3-(2-chlorophenyl)-N-(2-pyrazol-1-ylethyl)prop-2-enamide (PubChem CID 30460762) has the molecular formula C21H16Cl2N4OS and a molecular weight of 443.36 g/mol. Its IUPAC name is (E)-N-(4-chloro-1,3-benzothiazol-2-yl)-3-(2-chlorophenyl)-N-(2-pyrazol-1-ylethyl)prop-2-enamide.
| Compound Name | (E)-N-(4-chloro-1,3-benzothiazol-2-yl)-3-(2-chlorophenyl)-N-(2-pyrazol-1-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 30460762 |
| Molecular Formula | C21H16Cl2N4OS |
| Molecular Weight | 443.36 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | (E)-N-(4-chloro-1,3-benzothiazol-2-yl)-3-(2-chlorophenyl)-N-(2-pyrazol-1-ylethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1Cl)N(CCn1cccn1)c1nc2c(Cl)cccc2s1 |
| InChI | InChI=1S/C21H16Cl2N4OS/c22-16-6-2-1-5-15(16)9-10-19(28)27(14-13-26-12-4-11-24-26)21-25-20-17(23)7-3-8-18(20)29-21/h1-12H,13-14H2/b10-9+ |
| InChIKey | RMDILRKVLPKUBT-MDZDMXLPSA-N |
| XLogP | 5.55 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.36 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|