C20H21ClN3OS+ — CID 7510476
2-[(4-chloro-1,3-benzothiazol-2-yl)-[(E)-3-phenylprop-2-enoyl]amino]ethyl-dimethylazanium (PubChem CID 7510476) has the molecular formula C20H21ClN3OS+ and a molecular weight of 386.93 g/mol. Its IUPAC name is 2-[(4-chloro-1,3-benzothiazol-2-yl)-[(E)-3-phenylprop-2-enoyl]amino]ethyl-dimethylazanium.
| Compound Name | 2-[(4-chloro-1,3-benzothiazol-2-yl)-[(E)-3-phenylprop-2-enoyl]amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7510476 |
| Molecular Formula | C20H21ClN3OS+ |
| Molecular Weight | 386.93 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 2-[(4-chloro-1,3-benzothiazol-2-yl)-[(E)-3-phenylprop-2-enoyl]amino]ethyl-dimethylazanium |
| SMILES | C[NH+](C)CCN(C(=O)/C=C/c1ccccc1)c1nc2c(Cl)cccc2s1 |
| InChI | InChI=1S/C20H20ClN3OS/c1-23(2)13-14-24(18(25)12-11-15-7-4-3-5-8-15)20-22-19-16(21)9-6-10-17(19)26-20/h3-12H,13-14H2,1-2H3/p+1/b12-11+ |
| InChIKey | MCLHGKOIGKAXOZ-VAWYXSNFSA-O |
| XLogP | 3.14 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.93 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|