C20H20F2N3OS+ — CID 7511106
2-[(4,6-difluoro-1,3-benzothiazol-2-yl)-[(E)-3-phenylprop-2-enoyl]amino]ethyl-dimethylazanium (PubChem CID 7511106) has the molecular formula C20H20F2N3OS+ and a molecular weight of 388.46 g/mol. Its IUPAC name is 2-[(4,6-difluoro-1,3-benzothiazol-2-yl)-[(E)-3-phenylprop-2-enoyl]amino]ethyl-dimethylazanium.
| Compound Name | 2-[(4,6-difluoro-1,3-benzothiazol-2-yl)-[(E)-3-phenylprop-2-enoyl]amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7511106 |
| Molecular Formula | C20H20F2N3OS+ |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 2-[(4,6-difluoro-1,3-benzothiazol-2-yl)-[(E)-3-phenylprop-2-enoyl]amino]ethyl-dimethylazanium |
| SMILES | C[NH+](C)CCN(C(=O)/C=C/c1ccccc1)c1nc2c(F)cc(F)cc2s1 |
| InChI | InChI=1S/C20H19F2N3OS/c1-24(2)10-11-25(18(26)9-8-14-6-4-3-5-7-14)20-23-19-16(22)12-15(21)13-17(19)27-20/h3-9,12-13H,10-11H2,1-2H3/p+1/b9-8+ |
| InChIKey | MMVDZFJJORRQFU-CMDGGOBGSA-O |
| XLogP | 2.77 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|