C21H20ClF2N3OS — CID 41348722
(E)-3-(2-chlorophenyl)-N-(4,6-difluoro-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]prop-2-enamide (PubChem CID 41348722) has the molecular formula C21H20ClF2N3OS and a molecular weight of 435.93 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-(4,6-difluoro-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-(4,6-difluoro-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 41348722 |
| Molecular Formula | C21H20ClF2N3OS |
| Molecular Weight | 435.93 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-(4,6-difluoro-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]prop-2-enamide |
| SMILES | CN(C)CCCN(C(=O)/C=C/c1ccccc1Cl)c1nc2c(F)cc(F)cc2s1 |
| InChI | InChI=1S/C21H20ClF2N3OS/c1-26(2)10-5-11-27(19(28)9-8-14-6-3-4-7-16(14)22)21-25-20-17(24)12-15(23)13-18(20)29-21/h3-4,6-9,12-13H,5,10-11H2,1-2H3/b9-8+ |
| InChIKey | FKSOIWMKKUBWGB-CMDGGOBGSA-N |
| XLogP | 5.23 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.93 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|