C22H14ClF2N3OS — CID 41056156
(E)-3-(2-chlorophenyl)-N-(4,6-difluoro-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)prop-2-enamide (PubChem CID 41056156) has the molecular formula C22H14ClF2N3OS and a molecular weight of 441.89 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-(4,6-difluoro-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-(4,6-difluoro-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 41056156 |
| Molecular Formula | C22H14ClF2N3OS |
| Molecular Weight | 441.89 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-(4,6-difluoro-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1Cl)N(Cc1ccccn1)c1nc2c(F)cc(F)cc2s1 |
| InChI | InChI=1S/C22H14ClF2N3OS/c23-17-7-2-1-5-14(17)8-9-20(29)28(13-16-6-3-4-10-26-16)22-27-21-18(25)11-15(24)12-19(21)30-22/h1-12H,13H2/b9-8+ |
| InChIKey | LZKZCESICIKYRO-CMDGGOBGSA-N |
| XLogP | 5.87 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.89 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|