C20H12F2N4O3S — CID 41056122
N-(4,6-difluoro-1,3-benzothiazol-2-yl)-4-nitro-N-(pyridin-2-ylmethyl)benzamide (PubChem CID 41056122) has the molecular formula C20H12F2N4O3S and a molecular weight of 426.40 g/mol. Its IUPAC name is N-(4,6-difluoro-1,3-benzothiazol-2-yl)-4-nitro-N-(pyridin-2-ylmethyl)benzamide.
| Compound Name | N-(4,6-difluoro-1,3-benzothiazol-2-yl)-4-nitro-N-(pyridin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 41056122 |
| Molecular Formula | C20H12F2N4O3S |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | N-(4,6-difluoro-1,3-benzothiazol-2-yl)-4-nitro-N-(pyridin-2-ylmethyl)benzamide |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)N(Cc1ccccn1)c1nc2c(F)cc(F)cc2s1 |
| InChI | InChI=1S/C20H12F2N4O3S/c21-13-9-16(22)18-17(10-13)30-20(24-18)25(11-14-3-1-2-8-23-14)19(27)12-4-6-15(7-5-12)26(28)29/h1-10H,11H2 |
| InChIKey | LLVPVVBMLBMHPG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 89.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|