C19H18F2N4O3S — CID 41348680
N-(4,6-difluoro-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-4-nitrobenzamide (PubChem CID 41348680) has the molecular formula C19H18F2N4O3S and a molecular weight of 420.44 g/mol. Its IUPAC name is N-(4,6-difluoro-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-4-nitrobenzamide.
| Compound Name | N-(4,6-difluoro-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 41348680 |
| Molecular Formula | C19H18F2N4O3S |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | N-(4,6-difluoro-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-4-nitrobenzamide |
| SMILES | CN(C)CCCN(C(=O)c1ccc([N+](=O)[O-])cc1)c1nc2c(F)cc(F)cc2s1 |
| InChI | InChI=1S/C19H18F2N4O3S/c1-23(2)8-3-9-24(18(26)12-4-6-14(7-5-12)25(27)28)19-22-17-15(21)10-13(20)11-16(17)29-19/h4-7,10-11H,3,8-9H2,1-2H3 |
| InChIKey | ZDSSOXPMIYBPDC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|