C19H18FN5O5S — CID 41347642
N-[3-(dimethylamino)propyl]-N-(4-fluoro-1,3-benzothiazol-2-yl)-3,5-dinitrobenzamide (PubChem CID 41347642) has the molecular formula C19H18FN5O5S and a molecular weight of 447.45 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-N-(4-fluoro-1,3-benzothiazol-2-yl)-3,5-dinitrobenzamide.
| Compound Name | N-[3-(dimethylamino)propyl]-N-(4-fluoro-1,3-benzothiazol-2-yl)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 41347642 |
| Molecular Formula | C19H18FN5O5S |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-N-(4-fluoro-1,3-benzothiazol-2-yl)-3,5-dinitrobenzamide |
| SMILES | CN(C)CCCN(C(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)c1nc2c(F)cccc2s1 |
| InChI | InChI=1S/C19H18FN5O5S/c1-22(2)7-4-8-23(19-21-17-15(20)5-3-6-16(17)31-19)18(26)12-9-13(24(27)28)11-14(10-12)25(29)30/h3,5-6,9-11H,4,7-8H2,1-2H3 |
| InChIKey | RZFXGBWDIRJCCO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 122.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|