C18H17N5O5S — CID 41026835
N-(1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-3,5-dinitrobenzamide (PubChem CID 41026835) has the molecular formula C18H17N5O5S and a molecular weight of 415.43 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-3,5-dinitrobenzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 41026835 |
| Molecular Formula | C18H17N5O5S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-3,5-dinitrobenzamide |
| SMILES | CN(C)CCN(C(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H17N5O5S/c1-20(2)7-8-21(18-19-15-5-3-4-6-16(15)29-18)17(24)12-9-13(22(25)26)11-14(10-12)23(27)28/h3-6,9-11H,7-8H2,1-2H3 |
| InChIKey | LJUXKNPZEXLRGW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 122.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|