C20H23N4O3S+ — CID 7577344
2-[1,3-benzothiazol-2-yl-(4-nitrobenzoyl)amino]ethyl-diethylazanium (PubChem CID 7577344) has the molecular formula C20H23N4O3S+ and a molecular weight of 399.50 g/mol. Its IUPAC name is 2-[1,3-benzothiazol-2-yl-(4-nitrobenzoyl)amino]ethyl-diethylazanium.
| Compound Name | 2-[1,3-benzothiazol-2-yl-(4-nitrobenzoyl)amino]ethyl-diethylazanium |
|---|---|
| PubChem CID | 7577344 |
| Molecular Formula | C20H23N4O3S+ |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 2-[1,3-benzothiazol-2-yl-(4-nitrobenzoyl)amino]ethyl-diethylazanium |
| SMILES | CC[NH+](CC)CCN(C(=O)c1ccc([N+](=O)[O-])cc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C20H22N4O3S/c1-3-22(4-2)13-14-23(20-21-17-7-5-6-8-18(17)28-20)19(25)15-9-11-16(12-10-15)24(26)27/h5-12H,3-4,13-14H2,1-2H3/p+1 |
| InChIKey | UTRZQIUPOQIILY-UHFFFAOYSA-O |
| XLogP | 2.78 |
| TPSA | 80.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|